CAS 5810-42-4 appears in our catalog under these names: Tetrapropylammonium chloride, Tetra-n-propylammonium chloride, 99+% , Tetrapropylammonium Chloride, >97.0%(T), Tetrapropylammonium chloride, 94%, TETRAPROPYLAMMONIUM CHLORIDE, 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100g, 500g, 5g, 25g, 10G, 50G, 250g, 1kg.
Tetrapropylazanium chloride (CAS 5810-42-4) is a chemical compound with the molecular formula C12H28ClN and a molecular weight of 221.81 g/mol. IUPAC name: tetrapropylazanium chloride. InChIKey: FBEVECUEMUUFKM-UHFFFAOYSA-M.
| Molecular formula | C12H28ClN |
|---|---|
| Molecular weight | 221.81 g/mol |
| IUPAC name | tetrapropylazanium chloride |
| InChIKey | FBEVECUEMUUFKM-UHFFFAOYSA-M |
| SMILES | CCC[N+](CCC)(CCC)CCC.[Cl-] |
Computed by PubChem (NCBI)