cas: 2052-49-5 — see every product listed under this CAS number, including other names
Tetrabutylammonium Hydroxide (10% in Water) [Reagent for Ion-Pair Chromatography] (CAS 2052-49-5) is a chemical reagent available from Chemat. Available pack sizes: 25ml, 100ml. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | I0364-25ML |
| cas | 2052-49-5 |
| size | 25ml |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25ml | 365.70 Pln | |
| TCI | 100ml | 763.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
Tetrabutylazanium hydroxide (CAS 2052-49-5) is a chemical compound with the molecular formula C16H37NO and a molecular weight of 259.47 g/mol. IUPAC name: tetrabutylazanium hydroxide. InChIKey: VDZOOKBUILJEDG-UHFFFAOYSA-M.
| Molecular formula | C16H37NO |
|---|---|
| Molecular weight | 259.47 g/mol |
| IUPAC name | tetrabutylazanium hydroxide |
| InChIKey | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[OH-] |
Computed by PubChem (NCBI)