cas: 2052-49-5 — see every product listed under this CAS number, including other names
Tetrabutylammonium hydroxide, 40 wt.% (1.5M) solution in water (CAS 2052-49-5) is a chemical reagent available from Chemat. Available pack sizes: 1KG, 2.5KG, 50g, 250g. Offered by: Thermo Scientific (Acros).
| brand | Thermo Scientific (Acros) |
|---|---|
| catalog number | 176610010 |
| cas | 2052-49-5 |
| size | 1KG |
| availability | availability |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific (Acros) | 1KG | 1893.14 Pln | |
| Thermo Scientific (Acros) | 2.5KG | 3581.38 Pln | |
| Thermo Scientific (Acros) | 50g | 196.44 Pln | |
| Thermo Scientific (Acros) | 250g | 699.35 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | .% |
Tetrabutylazanium hydroxide (CAS 2052-49-5) is a chemical compound with the molecular formula C16H37NO and a molecular weight of 259.47 g/mol. IUPAC name: tetrabutylazanium hydroxide. InChIKey: VDZOOKBUILJEDG-UHFFFAOYSA-M.
| Molecular formula | C16H37NO |
|---|---|
| Molecular weight | 259.47 g/mol |
| IUPAC name | tetrabutylazanium hydroxide |
| InChIKey | VDZOOKBUILJEDG-UHFFFAOYSA-M |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.[OH-] |
Computed by PubChem (NCBI)