cas: 64-75-5 — see every product listed under this CAS number, including other names
Tetracycline (hydrochloride), 98.66% (CAS 64-75-5) is a chemical reagent available from Chemat. Available pack sizes: 10 g, 10mM/1mL, 50 g, 5 g, 25 g, 1 g, 500 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0474-10 g |
| cas | 64-75-5 |
| size | 10 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 g | 742.30 Pln | |
| MedChemExpress | 10mM/1mL | 384.71 Pln | |
| MedChemExpress | 50 g | 1155.61 Pln | |
| MedChemExpress | 5 g | 640.13 Pln | |
| MedChemExpress | 25 g | 983.78 Pln | |
| MedChemExpress | 1 g | 463.66 Pln | |
| MedChemExpress | 500 mg | 361.49 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.66% |
Tetracycline Hydrochloride (internal use) can cause developmental toxicity according to state or federal government labeling requirements.
Source: California Office of Environmental Health Hazard Assessment (OEHHA)
| Molecular formula | C22H25ClN2O8 |
|---|---|
| Molecular weight | 480.9 g/mol |
| IUPAC name | (4S,4aS,5aS,6S,12aR)-4-(dimethylamino)-1,6,10,11,12a-pentahydroxy-6-methyl-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide;hydrochloride |
| InChIKey | YCIHPQHVWDULOY-FMZCEJRJSA-N |
| SMILES | C[C@@]1([C@H]2C[C@H]3[C@@H](C(=O)C(=C([C@]3(C(=O)C2=C(C4=C1C=CC=C4O)O)O)O)C(=O)N)N(C)C)O.Cl |
Computed by PubChem (NCBI)