cas: 17919-34-5 — see every product listed under this CAS number, including other names
Tetraethyl ([1,1'-biphenyl]-4,4'-diylbis(methylene))bis(phosphonate), 98%, 98% (CAS 17919-34-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 50g, 100g, 500g, 75g, 200g, 300g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1137V5-5g |
| cas | 17919-34-5 |
| size | 5g |
| availability | 5500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 50g | 126.80 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 500g | 590.40 Pln | |
| Chemat | 75g | 155.60 Pln | |
| Chemat | 200g | 266.00 Pln | |
| Chemat | 300g | 366.80 Pln | |
| Chemat | 400g | 462.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(diethoxyphosphorylmethyl)-4-[4-(diethoxyphosphorylmethyl)phenyl]benzene (CAS 17919-34-5) is a chemical compound with the molecular formula C22H32O6P2 and a molecular weight of 454.4 g/mol. IUPAC name: 1-(diethoxyphosphorylmethyl)-4-[4-(diethoxyphosphorylmethyl)phenyl]benzene. InChIKey: DRCOGQJUVZRNSQ-UHFFFAOYSA-N.
| Molecular formula | C22H32O6P2 |
|---|---|
| Molecular weight | 454.4 g/mol |
| IUPAC name | 1-(diethoxyphosphorylmethyl)-4-[4-(diethoxyphosphorylmethyl)phenyl]benzene |
| InChIKey | DRCOGQJUVZRNSQ-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(CC1=CC=C(C=C1)C2=CC=C(C=C2)CP(=O)(OCC)OCC)OCC |
Computed by PubChem (NCBI)