cas: 29261-33-4 — see every product listed under this CAS number, including other names
Tetrafluorotetracyanoquinodimethane (purified by sublimation), >98.0%(N) (CAS 29261-33-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1131-100MG |
| cas | 29261-33-4 |
| size | 100mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 100mg | 729.57 Pln | |
| TCI | 1g | 4053.63 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(N) |
2-[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]propanedinitrile (CAS 29261-33-4) is a chemical compound with the molecular formula C12F4N4 and a molecular weight of 276.15 g/mol. IUPAC name: 2-[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]propanedinitrile. InChIKey: IXHWGNYCZPISET-UHFFFAOYSA-N.
| Molecular formula | C12F4N4 |
|---|---|
| Molecular weight | 276.15 g/mol |
| IUPAC name | 2-[4-(dicyanomethylidene)-2,3,5,6-tetrafluorocyclohexa-2,5-dien-1-ylidene]propanedinitrile |
| InChIKey | IXHWGNYCZPISET-UHFFFAOYSA-N |
| SMILES | C(#N)C(=C1C(=C(C(=C(C#N)C#N)C(=C1F)F)F)F)C#N |
Computed by PubChem (NCBI)