CAS 558-32-7 appears in our catalog under these names: Tetramethylammonium hexafluorophosphate/ 98+%, Tetramethylammonium Hexafluorophosphate, Tetramethylammonium hexafluorophosphate, 99% , Tetramethylammonium Hexafluorophosphate, Tetramethylammonium hexafluorophosphate 98%. Offered by: Chemat, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: 100g, 25g, 5g, 500g, 100 g, 25 g, 50 g.
Tetramethylazanium hexafluorophosphate (CAS 558-32-7) is a chemical compound with the molecular formula C4H12F6NP and a molecular weight of 219.11 g/mol. IUPAC name: tetramethylazanium hexafluorophosphate. InChIKey: ZFKULDQWLXAKIM-UHFFFAOYSA-N.
| Molecular formula | C4H12F6NP |
|---|---|
| Molecular weight | 219.11 g/mol |
| IUPAC name | tetramethylazanium hexafluorophosphate |
| InChIKey | ZFKULDQWLXAKIM-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)