Tetramethylammonium trifluoromethanethiolate, 98%
cas: 515823-30-0 — see every product listed under this CAS number, including other names
Tetramethylammonium trifluoromethanethiolate, 98% (CAS 515823-30-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g, 50g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A207961-250mg |
| cas | 515823-30-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 659.62 Pln | |
| Ambeed | 1g | 1844.44 Pln | |
| Ambeed | 5g | 5721.50 Pln | |
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 338.00 Pln | |
| Chemat | 1g | 750.80 Pln | |
| Chemat | 5g | 2128.40 Pln | |
| Chemat | 10g | 3506.00 Pln | |
| Chemat | 25g | 4850.00 Pln | |
| Chemat | 50g | 7067.60 Pln | |
| BLDpharm | 100mg | 342.13 Pln | |
| BLDpharm | 250mg | 703.11 Pln | |
| BLDpharm | 1g | 1808.28 Pln | |
| BLDpharm | 5g | 6162.30 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tetramethylazanium;trifluoromethanethiolate (CAS 515823-30-0) is a chemical compound with the molecular formula C5H12F3NS and a molecular weight of 175.22 g/mol. IUPAC name: tetramethylazanium;trifluoromethanethiolate. InChIKey: LTONLRVDOIFITJ-UHFFFAOYSA-M.
| Molecular formula | C5H12F3NS |
|---|---|
| Molecular weight | 175.22 g/mol |
| IUPAC name | tetramethylazanium;trifluoromethanethiolate |
| InChIKey | LTONLRVDOIFITJ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)C.C(F)(F)(F)[S-] |
Computed by PubChem (NCBI)
Synonyms:
Tetramethylammonium (trifluoromethyl)sulfanide, Tetramethylammonium trifluoromethanethiolate, tetramethylazanium trifluoromethanethiolate, tetramethylazanium;trifluoromethanethiolate, (trifluoromethyl)sulfanide; tetramethylazanium, Tetramethylammoniumtrifluoromethanethiolate, tetramethylammonium;trifluoromethanethiolate, tetramethylammonium trifluorometh-anethiolate