cas: 56211-70-2 — see every product listed under this CAS number, including other names
Tetrapropylammonium bisulfate, 97%, 97% (CAS 56211-70-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 15g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IA2F-1g |
| cas | 56211-70-2 |
| size | 1g |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 131.60 Pln | |
| Chemat | 25g | 366.80 Pln | |
| Chemat | 100g | 1101.20 Pln | |
| Chemat | 10g | 198.80 Pln | |
| Chemat | 15g | 266.00 Pln | |
| Chemat | 50g | 645.20 Pln | |
| Chemat | 75g | 923.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Hydrogen sulfate;tetrapropylazanium (CAS 56211-70-2) is a chemical compound with the molecular formula C12H29NO4S and a molecular weight of 283.43 g/mol. IUPAC name: hydrogen sulfate;tetrapropylazanium. InChIKey: MOXJKKOSZCHGEU-UHFFFAOYSA-M.
| Molecular formula | C12H29NO4S |
|---|---|
| Molecular weight | 283.43 g/mol |
| IUPAC name | hydrogen sulfate;tetrapropylazanium |
| InChIKey | MOXJKKOSZCHGEU-UHFFFAOYSA-M |
| SMILES | CCC[N+](CCC)(CCC)CCC.OS(=O)(=O)[O-] |
Computed by PubChem (NCBI)