cas: 30126-05-7 — see every product listed under this CAS number, including other names
Thieno[3,2-b][1]benzothiophene-2-carboxylicacid, 95%, 95% (CAS 30126-05-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BWII-100mg |
| cas | 30126-05-7 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 400.40 Pln | |
| Chemat | 1g | 741.20 Pln | |
| Chemat | 5g | 2013.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Thieno[3,2-b][1]benzothiole-2-carboxylic acid (CAS 30126-05-7) is a chemical compound with the molecular formula C11H6O2S2 and a molecular weight of 234.3 g/mol. IUPAC name: thieno[3,2-b][1]benzothiole-2-carboxylic acid. InChIKey: HJMXTNQVXZTBHZ-UHFFFAOYSA-N.
| Molecular formula | C11H6O2S2 |
|---|---|
| Molecular weight | 234.3 g/mol |
| IUPAC name | thieno[3,2-b][1]benzothiole-2-carboxylic acid |
| InChIKey | HJMXTNQVXZTBHZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(S2)C=C(S3)C(=O)O |
Computed by PubChem (NCBI)