cas: 866889-02-3 — see every product listed under this CAS number, including other names
Thiol–PEG8–acid (CAS 866889-02-3) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC65340-10 |
| cas | 866889-02-3 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 595.64 Pln | |
| GLPBio | 100mg | 1172.74 Pln | |
| GLPBio | 25mg | 719.67 Pln | |
| GLPBio | 50mg | 903.14 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[2-[2-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 866889-02-3) is a chemical compound with the molecular formula C19H38O10S and a molecular weight of 458.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: SKYJRDAORYSCAL-UHFFFAOYSA-N.
| Molecular formula | C19H38O10S |
|---|---|
| Molecular weight | 458.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | SKYJRDAORYSCAL-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCS)C(=O)O |
Computed by PubChem (NCBI)