cas: 1818294-40-4 — see every product listed under this CAS number, including other names
Thiol-peg6-t-butyl ester, 98%, 98% (CAS 1818294-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11345N-100mg |
| cas | 1818294-40-4 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1566.80 Pln | |
| Chemat | 250mg | 2618.00 Pln | |
| Chemat | 1g | 7264.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1818294-40-4) is a chemical compound with the molecular formula C19H38O8S and a molecular weight of 426.6 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: LPOFWHQVCATSPH-UHFFFAOYSA-N.
| Molecular formula | C19H38O8S |
|---|---|
| Molecular weight | 426.6 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | LPOFWHQVCATSPH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCOCCS |
Computed by PubChem (NCBI)