cas: 4282-29-5 — see every product listed under this CAS number, including other names
Thiophene-3,4-dicarboxylic acid, 98%, 98% (CAS 4282-29-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114USN-250mg |
| cas | 4282-29-5 |
| size | 250mg |
| availability | 2500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 112.40 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 309.20 Pln | |
| Chemat | 100g | 1000.40 Pln | |
| Chemat | 500g | 4305.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Thiophene-3,4-dicarboxylic acid (CAS 4282-29-5) is a chemical compound with the molecular formula C6H4O4S and a molecular weight of 172.16 g/mol. IUPAC name: thiophene-3,4-dicarboxylic acid. InChIKey: ZWWLLYJRPKYTDF-UHFFFAOYSA-N.
| Molecular formula | C6H4O4S |
|---|---|
| Molecular weight | 172.16 g/mol |
| IUPAC name | thiophene-3,4-dicarboxylic acid |
| InChIKey | ZWWLLYJRPKYTDF-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CS1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)