cas: 1807503-88-3 — see every product listed under this CAS number, including other names
Thp-ss-peg1-t-butyl ester 98% (CAS 1807503-88-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755362-50mg |
| cas | 1807503-88-3 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 403.75 Pln | |
| Ambeed | 100mg | 576.19 Pln | |
| Ambeed | 250mg | 965.56 Pln | |
| Ambeed | 1g | 2701.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A755362 |
Tert-butyl 3-[2-[2-(oxan-2-yloxy)ethyldisulfanyl]ethoxy]propanoate (CAS 1807503-88-3) is a chemical compound with the molecular formula C16H30O5S2 and a molecular weight of 366.5 g/mol. IUPAC name: tert-butyl 3-[2-[2-(oxan-2-yloxy)ethyldisulfanyl]ethoxy]propanoate. InChIKey: JTKJXQXCOWSQCZ-UHFFFAOYSA-N.
| Molecular formula | C16H30O5S2 |
|---|---|
| Molecular weight | 366.5 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(oxan-2-yloxy)ethyldisulfanyl]ethoxy]propanoate |
| InChIKey | JTKJXQXCOWSQCZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCSSCCOC1CCCCO1 |
Computed by PubChem (NCBI)