cas: 328898-40-4 — see every product listed under this CAS number, including other names
Tildipirosin, 99.95% (CAS 328898-40-4) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 5 mg, 10mM/1mL, 2 mg, 10 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-A0071-100 mg |
| cas | 328898-40-4 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 5493.11 Pln | |
| MedChemExpress | 5 mg | 1081.31 Pln | |
| MedChemExpress | 10mM/1mL | 1671.10 Pln | |
| MedChemExpress | 2 mg | 598.33 Pln | |
| MedChemExpress | 10 mg | 1657.16 Pln | |
| MedChemExpress | 50 mg | 3909.50 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.95% |
(4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-[(2R,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-16-ethyl-4-hydroxy-5,9,13-trimethyl-7-(2-piperidin-1-ylethyl)-15-(piperidin-1-ylmethyl)-1-oxacyclohexadeca-11,13-diene-2,10-dione (CAS 328898-40-4) is a chemical compound with the molecular formula C41H71N3O8 and a molecular weight of 734.0 g/mol. IUPAC name: (4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-[(2R,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-16-ethyl-4-hydroxy-5,9,13-trimethyl-7-(2-piperidin-1-ylethyl)-15-(piperidin-1-ylmethyl)-1-oxacyclohexadeca-11,13-diene-2,10-dione. InChIKey: HNDXPZPJZGTJLJ-UEJFNEDBSA-N.
| Molecular formula | C41H71N3O8 |
|---|---|
| Molecular weight | 734.0 g/mol |
| IUPAC name | (4R,5S,6S,7R,9R,11E,13E,15R,16R)-6-[(2R,3R,4S,5S,6R)-4-(dimethylamino)-3,5-dihydroxy-6-methyloxan-2-yl]oxy-16-ethyl-4-hydroxy-5,9,13-trimethyl-7-(2-piperidin-1-ylethyl)-15-(piperidin-1-ylmethyl)-1-oxacyclohexadeca-11,13-diene-2,10-dione |
| InChIKey | HNDXPZPJZGTJLJ-UEJFNEDBSA-N |
| SMILES | CC[C@@H]1[C@H](/C=C(/C=C/C(=O)[C@@H](C[C@@H]([C@@H]([C@H]([C@@H](CC(=O)O1)O)C)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)C)O)N(C)C)O)CCN3CCCCC3)C)\C)CN4CCCCC4 |
Computed by PubChem (NCBI)