cas: 51-24-1 — see every product listed under this CAS number, including other names
Tiratricol 98% (CAS 51-24-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A244345-1mg |
| cas | 51-24-1 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 275.81 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1588.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A244345 |
2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetic acid (CAS 51-24-1) is a chemical compound with the molecular formula C14H9I3O4 and a molecular weight of 621.93 g/mol. IUPAC name: 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetic acid. InChIKey: UOWZUVNAGUAEQC-UHFFFAOYSA-N.
| Molecular formula | C14H9I3O4 |
|---|---|
| Molecular weight | 621.93 g/mol |
| IUPAC name | 2-[4-(4-hydroxy-3-iodophenoxy)-3,5-diiodophenyl]acetic acid |
| InChIKey | UOWZUVNAGUAEQC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC2=C(C=C(C=C2I)CC(=O)O)I)I)O |
Computed by PubChem (NCBI)