CAS 14024-64-7 appears in our catalog under these names: Titanium(IV) oxyacetylacetonate, Titanium(IV) oxide bis(2,4-pentanedionate) , Bis(2,4-pentanedionato)titanium(IV) Oxide, Titanium(IV) oxyacetylacetonate 98%, TITANIUM(IV) OXYACETYLACETONATE, 90%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 100g, 500g, 10g, 50g, 250g, 25g, 1000g, 5g.
Bis(4-hydroxypent-3-en-2-one);oxotitanium (CAS 14024-64-7) is a chemical compound with the molecular formula C10H16O5Ti and a molecular weight of 264.10 g/mol. IUPAC name: bis(4-hydroxypent-3-en-2-one);oxotitanium. InChIKey: ADVORQMAWLEPOI-UHFFFAOYSA-N.
| Molecular formula | C10H16O5Ti |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | bis(4-hydroxypent-3-en-2-one);oxotitanium |
| InChIKey | ADVORQMAWLEPOI-UHFFFAOYSA-N |
| SMILES | CC(=CC(=O)C)O.CC(=CC(=O)C)O.O=[Ti] |
Computed by PubChem (NCBI)