cas: 26201-32-1 — see every product listed under this CAS number, including other names
Titanyl Phthalocyanine, 98% (CAS 26201-32-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F988340-100MG |
| cas | 26201-32-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 351.98 Pln | |
| Fluorochem | 5g | 940.31 Pln | |
| Fluorochem | 10g | 1513.03 Pln | |
| Fluorochem | 25g | 2330.45 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2,11,20,29,37,39-hexaza-38,40-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1,3,5,7,9,11,13,15,17,19(39),20,22,24,26,28,30(37),31,33,35-nonadecaene;oxotitanium(2+) (CAS 26201-32-1) is a chemical compound with the molecular formula C32H16N8OTi and a molecular weight of 576.4 g/mol. IUPAC name: 2,11,20,29,37,39-hexaza-38,40-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1,3,5,7,9,11,13,15,17,19(39),20,22,24,26,28,30(37),31,33,35-nonadecaene;oxotitanium(2+). InChIKey: SJHHDDDGXWOYOE-UHFFFAOYSA-N.
| Molecular formula | C32H16N8OTi |
|---|---|
| Molecular weight | 576.4 g/mol |
| IUPAC name | 2,11,20,29,37,39-hexaza-38,40-diazanidanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetraconta-1,3,5,7,9,11,13,15,17,19(39),20,22,24,26,28,30(37),31,33,35-nonadecaene;oxotitanium(2+) |
| InChIKey | SJHHDDDGXWOYOE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=NC4=NC(=NC5=C6C=CC=CC6=C([N-]5)N=C7C8=CC=CC=C8C(=N7)N=C2[N-]3)C9=CC=CC=C94.O=[Ti+2] |
Computed by PubChem (NCBI)