cas: 57436-38-1 — see every product listed under this CAS number, including other names
Tos-PEG8-Tos 98% (CAS 57436-38-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A535107-250mg |
| cas | 57436-38-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 453.81 Pln | |
| Ambeed | 1g | 1071.25 Pln | |
| Ambeed | 5g | 3424.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A535107 |
2-[2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (CAS 57436-38-1) is a chemical compound with the molecular formula C30H46O13S2 and a molecular weight of 678.8 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate. InChIKey: QYYVGRJXXOLFKL-UHFFFAOYSA-N.
| Molecular formula | C30H46O13S2 |
|---|---|
| Molecular weight | 678.8 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[2-(4-methylphenyl)sulfonyloxyethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| InChIKey | QYYVGRJXXOLFKL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)