cas: 2523025-40-1 — see every product listed under this CAS number, including other names
Tri(Amino-PEG3-amide)-amine 98% (CAS 2523025-40-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A756502-50mg |
| cas | 2523025-40-1 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 637.38 Pln | |
| Ambeed | 100mg | 987.81 Pln | |
| Ambeed | 250mg | 1822.19 Pln | |
| Ambeed | 1g | 4781.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A756502 |
3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-[2-[bis[2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoylamino]ethyl]amino]ethyl]propanamide (CAS 2523025-40-1) is a chemical compound with the molecular formula C33H69N7O12 and a molecular weight of 755.9 g/mol. IUPAC name: 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-[2-[bis[2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoylamino]ethyl]amino]ethyl]propanamide. InChIKey: IQSJMACFJXJKGK-UHFFFAOYSA-N.
| Molecular formula | C33H69N7O12 |
|---|---|
| Molecular weight | 755.9 g/mol |
| IUPAC name | 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]-N-[2-[bis[2-[3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoylamino]ethyl]amino]ethyl]propanamide |
| InChIKey | IQSJMACFJXJKGK-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCN)C(=O)NCCN(CCNC(=O)CCOCCOCCOCCN)CCNC(=O)CCOCCOCCOCCN |
Computed by PubChem (NCBI)