CAS 78-33-1 appears in our catalog under these names: Tris(p-tert-butylphenyl) Phosphate, >95% (HPLC), Tris(4-tert-butylphenyl) phosphate, Tris(4–Tert–Butylphenyl) Phosphate, Tri-(p-tert-butylphenyl)phosphate, 98%, 98%, Tri-(p-tert-butylphenyl) phosphate, 98.69%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10g, 1g, 50mg, 5g, 100mg, 250mg, 25g, 100 mg.
Tris(4-tert-butylphenyl) phosphate (CAS 78-33-1) is a chemical compound with the molecular formula C30H39O4P and a molecular weight of 494.6 g/mol. IUPAC name: tris(4-tert-butylphenyl) phosphate. InChIKey: LORSVOJSXMHDHF-UHFFFAOYSA-N.
| Molecular formula | C30H39O4P |
|---|---|
| Molecular weight | 494.6 g/mol |
| IUPAC name | tris(4-tert-butylphenyl) phosphate |
| InChIKey | LORSVOJSXMHDHF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)OP(=O)(OC2=CC=C(C=C2)C(C)(C)C)OC3=CC=C(C=C3)C(C)(C)C |
Computed by PubChem (NCBI)