cas: 100648-13-3 — see every product listed under this CAS number, including other names
Triclabendazole Sulfoxide (CAS 100648-13-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25mg, 1mg, 5mg, 10mg, 50mg, 100mg, 500mg. Offered by: TRC, TargetMol, GLPBio, Biosynth.
| brand | TRC |
|---|---|
| catalog number | TRC-T773830-250MG |
| cas | 100648-13-3 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| TRC | 250mg | price on request | |
| TRC | 25mg | price on request | |
| TargetMol | 1mg | 478.94 Pln | |
| TargetMol | 5mg | 864.09 Pln | |
| TargetMol | 10mg | 1196.14 Pln | |
| TargetMol | 25mg | 2019.55 Pln | |
| TargetMol | 50mg | 2703.76 Pln | |
| TargetMol | 100mg | 3785.99 Pln | |
| TargetMol | 500mg | 7704.02 Pln | |
| GLPBio | 1mg | 667.25 Pln | |
| GLPBio | 10mg | 1238.27 Pln | |
| GLPBio | 100mg | 3321.09 Pln | |
| GLPBio | 25mg | 1888.86 Pln | |
| GLPBio | 5mg | 962.12 Pln | |
| GLPBio | 50mg | 2487.96 Pln | |
| Biosynth | 250mg | price on request | |
| Sigma-Aldrich | 10MG | 822.00 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfinyl-1H-benzimidazole (CAS 100648-13-3) is a chemical compound with the molecular formula C14H9Cl3N2O2S and a molecular weight of 375.7 g/mol. IUPAC name: 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfinyl-1H-benzimidazole. InChIKey: GABQPFWIQFRJSE-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl3N2O2S |
|---|---|
| Molecular weight | 375.7 g/mol |
| IUPAC name | 6-chloro-5-(2,3-dichlorophenoxy)-2-methylsulfinyl-1H-benzimidazole |
| InChIKey | GABQPFWIQFRJSE-UHFFFAOYSA-N |
| SMILES | CS(=O)C1=NC2=CC(=C(C=C2N1)Cl)OC3=C(C(=CC=C3)Cl)Cl |
Computed by PubChem (NCBI)