cas: 18412-57-2 — see every product listed under this CAS number, including other names
Triethoxy(p-tolyl)silane, >95.0%(GC) (CAS 18412-57-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T3750-1G |
| cas | 18412-57-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 201.94 Pln | |
| TCI | 5g | 590.40 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
Triethoxy-(4-methylphenyl)silane (CAS 18412-57-2) is a chemical compound with the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. IUPAC name: triethoxy-(4-methylphenyl)silane. InChIKey: PADYPAQRESYCQZ-UHFFFAOYSA-N.
| Molecular formula | C13H22O3Si |
|---|---|
| Molecular weight | 254.40 g/mol |
| IUPAC name | triethoxy-(4-methylphenyl)silane |
| InChIKey | PADYPAQRESYCQZ-UHFFFAOYSA-N |
| SMILES | CCO[Si](C1=CC=C(C=C1)C)(OCC)OCC |
Computed by PubChem (NCBI)