Trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane, 98%
cas: 85877-79-8 — see every product listed under this CAS number, including other names
Trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane, 98% (CAS 85877-79-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g, 15g, 50g, 75g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A699819-1g |
| cas | 85877-79-8 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 203.50 Pln | |
| Ambeed | 25g | 464.94 Pln | |
| Ambeed | 100g | 871.00 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 184.40 Pln | |
| Chemat | 15g | 242.00 Pln | |
| Chemat | 25g | 309.20 Pln | |
| Chemat | 50g | 534.80 Pln | |
| Chemat | 75g | 765.20 Pln | |
| Chemat | 100g | 909.20 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 214.39 Pln | |
| BLDpharm | 25g | 497.63 Pln | |
| BLDpharm | 100g | 930.81 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane (CAS 85877-79-8) is a chemical compound with the molecular formula C9H13F9O3Si and a molecular weight of 368.27 g/mol. IUPAC name: trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane. InChIKey: IJROHELDTBDTPH-UHFFFAOYSA-N.
| Molecular formula | C9H13F9O3Si |
|---|---|
| Molecular weight | 368.27 g/mol |
| IUPAC name | trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| InChIKey | IJROHELDTBDTPH-UHFFFAOYSA-N |
| SMILES | CO[Si](CCC(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(OC)OC |
Computed by PubChem (NCBI)
Synonyms:
NONAFLUOROHEXYLTRIMETHOXYSILANE, ((Perfluorobutyl)ethyl)trimethoxysilane, Trimethoxy(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane, Trimethoxy(1H,1H,2H,2H-nonafluorohexyl)silane, Trimethoxy(1H,1H,2H,2H-perfluorohexyl)silane, C9H13F9O3Si, s25248, Trimethoxy(3,3,, 3,3,4,4,5,5,6,6,6-nonafluorohexyltrimethoxysilane, 1H,1H,2H,2H-Nonafluorohexyltrimethoxysilane