cas: 760952-88-3 — see every product listed under this CAS number, including other names
Tris(3-hydroxypropyltriazolylmethyl)amine, 98%, 98% (CAS 760952-88-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 50mg, 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GAB1-100g |
| cas | 760952-88-3 |
| size | 100g |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 8915.60 Pln | |
| Chemat | 50mg | 83.60 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 890.00 Pln | |
| Chemat | 10g | 1442.00 Pln | |
| Chemat | 25g | 2819.60 Pln | |
| Chemat | 50g | 5229.20 Pln | |
| Chemat | 250g | 16298.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[4-[[bis[[1-(3-hydroxypropyl)triazol-4-yl]methyl]amino]methyl]triazol-1-yl]propan-1-ol (CAS 760952-88-3) is a chemical compound with the molecular formula C18H30N10O3 and a molecular weight of 434.5 g/mol. IUPAC name: 3-[4-[[bis[[1-(3-hydroxypropyl)triazol-4-yl]methyl]amino]methyl]triazol-1-yl]propan-1-ol. InChIKey: VAKXPQHQQNOUEZ-UHFFFAOYSA-N.
| Molecular formula | C18H30N10O3 |
|---|---|
| Molecular weight | 434.5 g/mol |
| IUPAC name | 3-[4-[[bis[[1-(3-hydroxypropyl)triazol-4-yl]methyl]amino]methyl]triazol-1-yl]propan-1-ol |
| InChIKey | VAKXPQHQQNOUEZ-UHFFFAOYSA-N |
| SMILES | C1=C(N=NN1CCCO)CN(CC2=CN(N=N2)CCCO)CC3=CN(N=N3)CCCO |
Computed by PubChem (NCBI)