cas: 2085-33-8 — see every product listed under this CAS number, including other names
Tris-(8-hydroxyquinoline)aluminum, 97% (CAS 2085-33-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114APJ-5g |
| cas | 2085-33-8 |
| size | 5g |
| availability | 800g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 93.20 Pln | |
| Chemat | 1g | 78.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tri(quinolin-8-yloxy)alumane (CAS 2085-33-8) is a chemical compound with the molecular formula C27H18AlN3O3 and a molecular weight of 459.4 g/mol. IUPAC name: tri(quinolin-8-yloxy)alumane. InChIKey: TVIVIEFSHFOWTE-UHFFFAOYSA-K.
| Molecular formula | C27H18AlN3O3 |
|---|---|
| Molecular weight | 459.4 g/mol |
| IUPAC name | tri(quinolin-8-yloxy)alumane |
| InChIKey | TVIVIEFSHFOWTE-UHFFFAOYSA-K |
| SMILES | C1=CC2=C(C(=C1)O[Al](OC3=CC=CC4=C3N=CC=C4)OC5=CC=CC6=C5N=CC=C6)N=CC=C2 |
Computed by PubChem (NCBI)