Trityl candesartan, 97%
cas: 139481-72-4 — see every product listed under this CAS number, including other names
Trityl candesartan, 97% (CAS 139481-72-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch118Z9Q-250mg |
| cas | 139481-72-4 |
| size | 250mg |
| availability | 700g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 290.00 Pln | |
| Chemat | 25g | 866.00 Pln | |
| Chemat | 100g | 2483.60 Pln | |
| Fluorochem | 25g | 2340.86 Pln | |
| Fluorochem | 100g | 7136.05 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 747.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-ethoxy-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid (CAS 139481-72-4) is a chemical compound with the molecular formula C43H34N6O3 and a molecular weight of 682.8 g/mol. IUPAC name: 2-ethoxy-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid. InChIKey: VBMKOTRJWPIKMG-UHFFFAOYSA-N.
| Molecular formula | C43H34N6O3 |
|---|---|
| Molecular weight | 682.8 g/mol |
| IUPAC name | 2-ethoxy-3-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-4-carboxylic acid |
| InChIKey | VBMKOTRJWPIKMG-UHFFFAOYSA-N |
| SMILES | CCOC1=NC2=CC=CC(=C2N1CC3=CC=C(C=C3)C4=CC=CC=C4C5=NN=NN5C(C6=CC=CC=C6)(C7=CC=CC=C7)C8=CC=CC=C8)C(=O)O |
Computed by PubChem (NCBI)