Trk-IN-9
cas: 2758623-12-8 — see every product listed under this CAS number, including other names
Trk-IN-9 (CAS 2758623-12-8) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 50 mg. Offered by: TargetMol, Chemat, MedChemExpress.
| brand | TargetMol |
|---|---|
| catalog number | T62806-1mg |
| cas | 2758623-12-8 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 797.57 Pln | |
| TargetMol | 5mg | 1634.39 Pln | |
| TargetMol | 10mg | 2331.47 Pln | |
| TargetMol | 25mg | 3785.99 Pln | |
| TargetMol | 50mg | 5326.59 Pln | |
| TargetMol | 100mg | 7073.46 Pln | |
| TargetMol | 500mg | 18429.55 Pln | |
| Chemat | 500mg | 13701.20 Pln | |
| MedChemExpress | 50 mg | 7629.35 Pln | |
| MedChemExpress | 10 mg | 3263.99 Pln | |
| MedChemExpress | 1 mg | 997.72 Pln | |
| MedChemExpress | 25 mg | 5381.65 Pln | |
| MedChemExpress | 5 mg | 2214.44 Pln | |
| Chemat | 1mg | 510.80 Pln | |
| Chemat | 5mg | 1139.60 Pln | |
| Chemat | 10mg | 1677.20 Pln | |
| Chemat | 25mg | 2800.40 Pln | |
| Chemat | 50mg | 3976.40 Pln | |
| Chemat | 100mg | 5421.20 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
3-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]-N-[(3R)-piperidin-3-yl]benzamide (CAS 2758623-12-8) is a chemical compound with the molecular formula C23H24ClFN6O and a molecular weight of 454.9 g/mol. IUPAC name: 3-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]-N-[(3R)-piperidin-3-yl]benzamide. InChIKey: DUAIEVYTIKHMGW-LJQANCHMSA-N.
| Molecular formula | C23H24ClFN6O |
|---|---|
| Molecular weight | 454.9 g/mol |
| IUPAC name | 3-[[5-chloro-4-[(3-fluorophenyl)methylamino]pyrimidin-2-yl]amino]-N-[(3R)-piperidin-3-yl]benzamide |
| InChIKey | DUAIEVYTIKHMGW-LJQANCHMSA-N |
| SMILES | C1C[C@H](CNC1)NC(=O)C2=CC(=CC=C2)NC3=NC=C(C(=N3)NCC4=CC(=CC=C4)F)Cl |
Computed by PubChem (NCBI)