Upadacitinib 99%
cas: 1310726-60-3 — see every product listed under this CAS number, including other names
Upadacitinib 99% (CAS 1310726-60-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A165008-1mg |
| cas | 1310726-60-3 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 131.19 Pln | |
| Ambeed | 5mg | 220.19 Pln | |
| Ambeed | 10mg | 303.62 Pln | |
| Ambeed | 25mg | 520.56 Pln | |
| Ambeed | 50mg | 871.00 Pln | |
| Ambeed | 100mg | 1432.81 Pln | |
| Ambeed | 250mg | 2061.38 Pln | |
| Ambeed | 1g | 4469.94 Pln | |
| Ambeed | 5g | 9759.88 Pln | |
| Ambeed | 10g | 15572.69 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A165008 |
(3S,4R)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-N-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide (CAS 1310726-60-3) is a chemical compound with the molecular formula C17H19F3N6O and a molecular weight of 380.4 g/mol. IUPAC name: (3S,4R)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-N-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide. InChIKey: WYQFJHHDOKWSHR-MNOVXSKESA-N.
| Molecular formula | C17H19F3N6O |
|---|---|
| Molecular weight | 380.4 g/mol |
| IUPAC name | (3S,4R)-3-ethyl-4-(1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl)-N-(2,2,2-trifluoroethyl)pyrrolidine-1-carboxamide |
| InChIKey | WYQFJHHDOKWSHR-MNOVXSKESA-N |
| SMILES | CC[C@@H]1CN(C[C@@H]1C2=CN=C3N2C4=C(NC=C4)N=C3)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)