cas: 208252-67-9 — see every product listed under this CAS number, including other names
Urea, (4-methoxy-6-methyl-1,3,5-triazin-2-yl)-, 95%, 95% (CAS 208252-67-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113JLJ-100mg |
| cas | 208252-67-9 |
| size | 100mg |
| availability | 1.23g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1163.60 Pln | |
| Chemat | 1g | 2819.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea (CAS 208252-67-9) is a chemical compound with the molecular formula C6H9N5O2 and a molecular weight of 183.17 g/mol. IUPAC name: (4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea. InChIKey: NEVDMPLXCGERDI-UHFFFAOYSA-N.
| Molecular formula | C6H9N5O2 |
|---|---|
| Molecular weight | 183.17 g/mol |
| IUPAC name | (4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea |
| InChIKey | NEVDMPLXCGERDI-UHFFFAOYSA-N |
| SMILES | CC1=NC(=NC(=N1)OC)NC(=O)N |
Computed by PubChem (NCBI)