CAS 27821-45-0 appears in our catalog under these names: Uridine 5'-diphosphoric acid disodium salt, 97%, Uridine 5'-diphosphate Disodium Salt, Uridine-5'-diphosphate disodium salt/ 100%, UDP disodium salt, Uridine–5'–diphosphate disodium salt. Offered by: Combi-blocks, Chemat Brand, TargetMol, GLPBio, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 25g, 5g, on request, 50mg, 100mg, 500mg, 10mM (in 1ml water).
Disodium;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate (CAS 27821-45-0) is a chemical compound with the molecular formula C9H12N2Na2O12P2 and a molecular weight of 448.12 g/mol. IUPAC name: disodium;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate. InChIKey: ZQKVPFKBNNAXCE-WFIJOQBCSA-L.
| Molecular formula | C9H12N2Na2O12P2 |
|---|---|
| Molecular weight | 448.12 g/mol |
| IUPAC name | disodium;[[(2R,3S,4R,5R)-5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methoxy-oxidophosphoryl] hydrogen phosphate |
| InChIKey | ZQKVPFKBNNAXCE-WFIJOQBCSA-L |
| SMILES | C1=CN(C(=O)NC1=O)[C@H]2[C@@H]([C@@H]([C@H](O2)COP(=O)([O-])OP(=O)(O)[O-])O)O.[Na+].[Na+] |
Computed by PubChem (NCBI)