cas: 1052515-91-9 — see every product listed under this CAS number, including other names
VU0134992 HCl 97% (CAS 1052515-91-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1324873-1mg |
| cas | 1052515-91-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 170.12 Pln | |
| Ambeed | 5mg | 281.38 Pln | |
| Ambeed | 10mg | 370.38 Pln | |
| Ambeed | 50mg | 921.06 Pln | |
| Ambeed | 100mg | 1265.94 Pln | |
| Ambeed | 250mg | 2122.56 Pln | |
| Ambeed | 1g | 5565.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1324873 |
2-(2-bromo-4-propan-2-ylphenoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;hydrochloride (CAS 1052515-91-9) is a chemical compound with the molecular formula C20H32BrClN2O2 and a molecular weight of 447.8 g/mol. IUPAC name: 2-(2-bromo-4-propan-2-ylphenoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;hydrochloride. InChIKey: QXKQUPCNSXWIDX-UHFFFAOYSA-N.
| Molecular formula | C20H32BrClN2O2 |
|---|---|
| Molecular weight | 447.8 g/mol |
| IUPAC name | 2-(2-bromo-4-propan-2-ylphenoxy)-N-(2,2,6,6-tetramethylpiperidin-4-yl)acetamide;hydrochloride |
| InChIKey | QXKQUPCNSXWIDX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)OCC(=O)NC2CC(NC(C2)(C)C)(C)C)Br.Cl |
Computed by PubChem (NCBI)