cas: 932710-56-0 — see every product listed under this CAS number, including other names
Valeraldehyde-O-pentafluorophenylmethyl-oxime, 95%, 95% (CAS 932710-56-0) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1175LN-25mg |
| cas | 932710-56-0 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 736.40 Pln | |
| Chemat | 100mg | 1302.80 Pln | |
| Chemat | 250mg | 2128.40 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]pentan-1-imine (CAS 932710-56-0) is a chemical compound with the molecular formula C12H12F5NO and a molecular weight of 281.22 g/mol. IUPAC name: (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]pentan-1-imine. InChIKey: CQVUQQBKUBLHIZ-BLLMUTORSA-N.
| Molecular formula | C12H12F5NO |
|---|---|
| Molecular weight | 281.22 g/mol |
| IUPAC name | (E)-N-[(2,3,4,5,6-pentafluorophenyl)methoxy]pentan-1-imine |
| InChIKey | CQVUQQBKUBLHIZ-BLLMUTORSA-N |
| SMILES | CCCC/C=N/OCC1=C(C(=C(C(=C1F)F)F)F)F |
Computed by PubChem (NCBI)