cas: 133868-46-9 — see every product listed under this CAS number, including other names
Valnemulin (hydrochloride), 98.13% (CAS 133868-46-9) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 10 mg, 50 mg, 5 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0027-100 mg |
| cas | 133868-46-9 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 700.50 Pln | |
| MedChemExpress | 10 mg | 384.71 Pln | |
| MedChemExpress | 50 mg | 491.52 Pln | |
| MedChemExpress | 5 mg | 287.18 Pln | |
| MedChemExpress | 10mM/1mL | 412.57 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.13% |
[(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-methylpropan-2-yl]sulfanylacetate;hydrochloride (CAS 133868-46-9) is a chemical compound with the molecular formula C31H53ClN2O5S and a molecular weight of 601.3 g/mol. IUPAC name: [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-methylpropan-2-yl]sulfanylacetate;hydrochloride. InChIKey: MFBPRQKHDIVLOJ-AFFLPQGKSA-N.
| Molecular formula | C31H53ClN2O5S |
|---|---|
| Molecular weight | 601.3 g/mol |
| IUPAC name | [(1S,2R,3S,4S,6R,7R,8R,14R)-4-ethenyl-3-hydroxy-2,4,7,14-tetramethyl-9-oxo-6-tricyclo[5.4.3.01,8]tetradecanyl] 2-[1-[[(2R)-2-amino-3-methylbutanoyl]amino]-2-methylpropan-2-yl]sulfanylacetate;hydrochloride |
| InChIKey | MFBPRQKHDIVLOJ-AFFLPQGKSA-N |
| SMILES | C[C@@H]1CC[C@@]23CCC(=O)[C@H]2[C@@]1([C@@H](C[C@@]([C@H]([C@@H]3C)O)(C)C=C)OC(=O)CSC(C)(C)CNC(=O)[C@@H](C(C)C)N)C.Cl |
Computed by PubChem (NCBI)