CAS 3153-26-2 appears in our catalog under these names: Vanadium(IV) Oxide Acetylacetonate, Vanadyl acetylacetonate, Vanadium(IV) oxide bis(2,4-pentanedionate) , Bis(2,4-pentanedionato)vanadium(IV) Oxide, >95.0%(T), Vanadyl(IV) acetylacetonate, 99%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 10g, 25g, 5g, 250g, 50g, 1KG, 1000g, 100g.
Oxovanadium(2+);bis(pentane-2,4-dione) (CAS 3153-26-2) is a chemical compound with the molecular formula C10H14O5V and a molecular weight of 265.16 g/mol. IUPAC name: oxovanadium(2+);bis(pentane-2,4-dione). InChIKey: WVPMIMFMIGMEHW-UHFFFAOYSA-N.
| Molecular formula | C10H14O5V |
|---|---|
| Molecular weight | 265.16 g/mol |
| IUPAC name | oxovanadium(2+);bis(pentane-2,4-dione) |
| InChIKey | WVPMIMFMIGMEHW-UHFFFAOYSA-N |
| SMILES | CC(=O)[CH-]C(=O)C.CC(=O)[CH-]C(=O)C.O=[V+2] |
Computed by PubChem (NCBI)