cas: 646502-53-6 — see every product listed under this CAS number, including other names
VcMMAE 98% (CAS 646502-53-6) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A153774-1mg |
| cas | 646502-53-6 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 264.69 Pln | |
| Ambeed | 5mg | 303.62 Pln | |
| Ambeed | 10mg | 492.75 Pln | |
| Ambeed | 25mg | 1099.06 Pln | |
| Ambeed | 50mg | 1304.88 Pln | |
| Ambeed | 100mg | 1755.44 Pln | |
| Ambeed | 250mg | 2523.06 Pln | |
| Ambeed | 1g | 7412.50 Pln | |
| Ambeed | 5g | 29440.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A153774 |
(2S)-N-[(2S)-1-[[(3R,5S)-1-[(2S)-2-[(1R,2R)-3-[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidin-1-yl]-3-methoxy-5-methyl-1-oxoheptan-4-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide (CAS 646502-53-6) is a chemical compound with the molecular formula C39H67N5O7 and a molecular weight of 718.0 g/mol. IUPAC name: (2S)-N-[(2S)-1-[[(3R,5S)-1-[(2S)-2-[(1R,2R)-3-[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidin-1-yl]-3-methoxy-5-methyl-1-oxoheptan-4-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide. InChIKey: DASWEROEPLKSEI-AWNAIHLBSA-N.
| Molecular formula | C39H67N5O7 |
|---|---|
| Molecular weight | 718.0 g/mol |
| IUPAC name | (2S)-N-[(2S)-1-[[(3R,5S)-1-[(2S)-2-[(1R,2R)-3-[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]amino]-1-methoxy-2-methyl-3-oxopropyl]pyrrolidin-1-yl]-3-methoxy-5-methyl-1-oxoheptan-4-yl]-methylamino]-3-methyl-1-oxobutan-2-yl]-3-methyl-2-(methylamino)butanamide |
| InChIKey | DASWEROEPLKSEI-AWNAIHLBSA-N |
| SMILES | CC[C@H](C)C([C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@@H](C)C(=O)N[C@H](C)[C@H](C2=CC=CC=C2)O)OC)OC)N(C)C(=O)[C@H](C(C)C)NC(=O)[C@H](C(C)C)NC |
Computed by PubChem (NCBI)