CAS 1648737-78-3 appears in our catalog under these names: (R)-(1-Methylpyrrolidin-3-yl)methyl (3'-chloro-4'-fluoro-[1,1'-biphenyl]-2-yl)carbamate, 99%, 99%, Velufenacin/ 98.88% (existing batch purity), Velufenacin, Velufenacin, 99.12%. Offered by: Chemat, TargetMol, GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 1mg, 5mg, 100mg, 200mg, 10mM (in 1ml dmso).
[(3R)-1-methylpyrrolidin-3-yl]methyl N-[2-(3-chloro-4-fluorophenyl)phenyl]carbamate (CAS 1648737-78-3) is a chemical compound with the molecular formula C19H20ClFN2O2 and a molecular weight of 362.8 g/mol. IUPAC name: [(3R)-1-methylpyrrolidin-3-yl]methyl N-[2-(3-chloro-4-fluorophenyl)phenyl]carbamate. InChIKey: SYBGVVSJNMTWCI-CYBMUJFWSA-N.
| Molecular formula | C19H20ClFN2O2 |
|---|---|
| Molecular weight | 362.8 g/mol |
| IUPAC name | [(3R)-1-methylpyrrolidin-3-yl]methyl N-[2-(3-chloro-4-fluorophenyl)phenyl]carbamate |
| InChIKey | SYBGVVSJNMTWCI-CYBMUJFWSA-N |
| SMILES | CN1CC[C@H](C1)COC(=O)NC2=CC=CC=C2C3=CC(=C(C=C3)F)Cl |
Computed by PubChem (NCBI)