cas: 1702967-37-0 — see every product listed under this CAS number, including other names
Vipivotide tetraxetan 99% (CAS 1702967-37-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1177046-1mg |
| cas | 1702967-37-0 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 492.75 Pln | |
| Ambeed | 2mg | 709.69 Pln | |
| Ambeed | 5mg | 1338.25 Pln | |
| Ambeed | 10mg | 2211.56 Pln | |
| Ambeed | 25mg | 4369.81 Pln | |
| Ambeed | 50mg | 7796.31 Pln | |
| Ambeed | 100mg | 11584.38 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1177046 |
(2S)-2-[[(1S)-1-carboxy-5-[[(2S)-3-naphthalen-2-yl-2-[[4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]cyclohexanecarbonyl]amino]propanoyl]amino]pentyl]carbamoylamino]pentanedioic acid (CAS 1702967-37-0) is a chemical compound with the molecular formula C49H71N9O16 and a molecular weight of 1042.1 g/mol. IUPAC name: (2S)-2-[[(1S)-1-carboxy-5-[[(2S)-3-naphthalen-2-yl-2-[[4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]cyclohexanecarbonyl]amino]propanoyl]amino]pentyl]carbamoylamino]pentanedioic acid. InChIKey: JBHPLHATEXGMQR-VLOIPPKDSA-N.
| Molecular formula | C49H71N9O16 |
|---|---|
| Molecular weight | 1042.1 g/mol |
| IUPAC name | (2S)-2-[[(1S)-1-carboxy-5-[[(2S)-3-naphthalen-2-yl-2-[[4-[[[2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetyl]amino]methyl]cyclohexanecarbonyl]amino]propanoyl]amino]pentyl]carbamoylamino]pentanedioic acid |
| InChIKey | JBHPLHATEXGMQR-VLOIPPKDSA-N |
| SMILES | C1CC(CCC1CNC(=O)CN2CCN(CCN(CCN(CC2)CC(=O)O)CC(=O)O)CC(=O)O)C(=O)N[C@@H](CC3=CC4=CC=CC=C4C=C3)C(=O)NCCCC[C@@H](C(=O)O)NC(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)