cas: 748798-97-2 — see every product listed under this CAS number, including other names
WAY-640414, ≥98%, ≥98% (CAS 748798-97-2) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1EXKTD-5mg |
| cas | 748798-97-2 |
| size | 5mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 774.80 Pln | |
| Chemat | 25mg | 2901.20 Pln | |
| Chemat | 50mg | 4442.00 Pln | |
| Chemat | 100mg | 7365.20 Pln |
| purity | ≥98% |
|---|---|
| delivery time | 3 weeks |
N-(2-benzylphenyl)-2-pyrrolidin-1-ylacetamide (CAS 748798-97-2) is a chemical compound with the molecular formula C19H22N2O and a molecular weight of 294.4 g/mol. IUPAC name: N-(2-benzylphenyl)-2-pyrrolidin-1-ylacetamide. InChIKey: YMIGTOJYERTOJB-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O |
|---|---|
| Molecular weight | 294.4 g/mol |
| IUPAC name | N-(2-benzylphenyl)-2-pyrrolidin-1-ylacetamide |
| InChIKey | YMIGTOJYERTOJB-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CC(=O)NC2=CC=CC=C2CC3=CC=CC=C3 |
Computed by PubChem (NCBI)