CAS 150849-52-8 appears in our catalog under these names: WST-1, >95% (HPLC), WST-1/ 97.39% (existing batch purity), WST–1, WST-1, 5-(2,4-Disulfophenyl)-2-(4-iodophenyl)-3-(4-nitrophenyl)-2H-tetrazolium inner salt sodium salt (1:1), 90%, 90%. Offered by: TRC, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 250mg, 25mg, 10mg, 50mg, 10mM (in 1ml dmso), 0,05g, 0,1g.
Sodium 4-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-3-ium-5-yl]benzene-1,3-disulfonate (CAS 150849-52-8) is a chemical compound with the molecular formula C19H11IN5NaO8S2 and a molecular weight of 651.3 g/mol. IUPAC name: sodium 4-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-3-ium-5-yl]benzene-1,3-disulfonate. InChIKey: JUJBNYBVVQSIOU-UHFFFAOYSA-M.
| Molecular formula | C19H11IN5NaO8S2 |
|---|---|
| Molecular weight | 651.3 g/mol |
| IUPAC name | sodium 4-[2-(4-iodophenyl)-3-(4-nitrophenyl)tetrazol-3-ium-5-yl]benzene-1,3-disulfonate |
| InChIKey | JUJBNYBVVQSIOU-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1N2N=C(N=[N+]2C3=CC=C(C=C3)[N+](=O)[O-])C4=C(C=C(C=C4)S(=O)(=O)[O-])S(=O)(=O)[O-])I.[Na+] |
Computed by PubChem (NCBI)