cas: 947669-91-2 — see every product listed under this CAS number, including other names
WWL70 99% (CAS 947669-91-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A739931-1mg |
| cas | 947669-91-2 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 298.06 Pln | |
| Ambeed | 5mg | 526.12 Pln | |
| Ambeed | 10mg | 776.44 Pln | |
| Ambeed | 25mg | 1316.00 Pln | |
| Ambeed | 50mg | 1816.62 Pln | |
| Ambeed | 100mg | 2600.94 Pln | |
| Ambeed | 250mg | 6394.56 Pln |
| purity | 99% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A739931 |
[4-(4-carbamoylphenyl)phenyl] N-methyl-N-[(3-pyridin-4-ylphenyl)methyl]carbamate (CAS 947669-91-2) is a chemical compound with the molecular formula C27H23N3O3 and a molecular weight of 437.5 g/mol. IUPAC name: [4-(4-carbamoylphenyl)phenyl] N-methyl-N-[(3-pyridin-4-ylphenyl)methyl]carbamate. InChIKey: QTWNORFUQILKJL-UHFFFAOYSA-N.
| Molecular formula | C27H23N3O3 |
|---|---|
| Molecular weight | 437.5 g/mol |
| IUPAC name | [4-(4-carbamoylphenyl)phenyl] N-methyl-N-[(3-pyridin-4-ylphenyl)methyl]carbamate |
| InChIKey | QTWNORFUQILKJL-UHFFFAOYSA-N |
| SMILES | CN(CC1=CC(=CC=C1)C2=CC=NC=C2)C(=O)OC3=CC=C(C=C3)C4=CC=C(C=C4)C(=O)N |
Computed by PubChem (NCBI)