cas: 84104-71-2 — see every product listed under this CAS number, including other names
Wilforlide A, 98+%, 98+% (CAS 84104-71-2) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G4A9-50mg |
| cas | 84104-71-2 |
| size | 50mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 381.20 Pln | |
| Chemat | 100mg | 702.80 Pln |
| purity | 98+% |
|---|---|
| delivery time | 3 weeks |
(1S,2R,5S,6R,9R,11S,14R,15R,19S,21S)-11-hydroxy-2,5,6,10,10,14,21-heptamethyl-23-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-17-en-22-one (CAS 84104-71-2) is a chemical compound with the molecular formula C30H46O3 and a molecular weight of 454.7 g/mol. IUPAC name: (1S,2R,5S,6R,9R,11S,14R,15R,19S,21S)-11-hydroxy-2,5,6,10,10,14,21-heptamethyl-23-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-17-en-22-one. InChIKey: HHQJBWYXBWOFJY-YLXTXNMFSA-N.
| Molecular formula | C30H46O3 |
|---|---|
| Molecular weight | 454.7 g/mol |
| IUPAC name | (1S,2R,5S,6R,9R,11S,14R,15R,19S,21S)-11-hydroxy-2,5,6,10,10,14,21-heptamethyl-23-oxahexacyclo[19.2.1.02,19.05,18.06,15.09,14]tetracos-17-en-22-one |
| InChIKey | HHQJBWYXBWOFJY-YLXTXNMFSA-N |
| SMILES | C[C@]12CC[C@@H](C([C@@H]1CC[C@@]3([C@@H]2CC=C4[C@]3(CC[C@@]5([C@H]4C[C@]6(C[C@@H]5OC6=O)C)C)C)C)(C)C)O |
Computed by PubChem (NCBI)