cas: 114162-64-0 — see every product listed under this CAS number, including other names
X-Gluc (cyclohexanamine), 99.84% (CAS 114162-64-0) is a chemical reagent available from Chemat. Available pack sizes: 10 mg, 5 mg, 25 mg, 100 mg, 50 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-15935B-10 mg |
| cas | 114162-64-0 |
| size | 10 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10 mg | 333.62 Pln | |
| MedChemExpress | 5 mg | 263.96 Pln | |
| MedChemExpress | 25 mg | 528.67 Pln | |
| MedChemExpress | 100 mg | 1081.31 Pln | |
| MedChemExpress | 50 mg | 742.30 Pln | |
| MedChemExpress | 10mM/1mL | 282.54 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.84% |
(2S,3S,4S,5R,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid;cyclohexanamine (CAS 114162-64-0) is a chemical compound with the molecular formula C20H26BrClN2O7 and a molecular weight of 521.8 g/mol. IUPAC name: (2S,3S,4S,5R,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid;cyclohexanamine. InChIKey: JXCKZXHCJOVIAV-CYRSAHDMSA-N.
| Molecular formula | C20H26BrClN2O7 |
|---|---|
| Molecular weight | 521.8 g/mol |
| IUPAC name | (2S,3S,4S,5R,6S)-6-[(5-bromo-4-chloro-1H-indol-3-yl)oxy]-3,4,5-trihydroxyoxane-2-carboxylic acid;cyclohexanamine |
| InChIKey | JXCKZXHCJOVIAV-CYRSAHDMSA-N |
| SMILES | C1CCC(CC1)N.C1=CC(=C(C2=C1NC=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)C(=O)O)O)O)O)Cl)Br |
Computed by PubChem (NCBI)