cas: 1936529-65-5 — see every product listed under this CAS number, including other names
YKL-05-099 98% (CAS 1936529-65-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A723778-1mg |
| cas | 1936529-65-5 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 364.81 Pln | |
| Ambeed | 5mg | 592.88 Pln | |
| Ambeed | 10mg | 876.56 Pln | |
| Ambeed | 25mg | 1466.19 Pln | |
| Ambeed | 50mg | 2122.56 Pln | |
| Ambeed | 100mg | 3045.94 Pln | |
| Ambeed | 250mg | 5977.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A723778 |
3-(2-chloro-6-methylphenyl)-7-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-1-(5-methoxy-2-pyridinyl)-4H-pyrimido[4,5-d]pyrimidin-2-one (CAS 1936529-65-5) is a chemical compound with the molecular formula C32H34ClN7O3 and a molecular weight of 600.1 g/mol. IUPAC name: 3-(2-chloro-6-methylphenyl)-7-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-1-(5-methoxy-2-pyridinyl)-4H-pyrimido[4,5-d]pyrimidin-2-one. InChIKey: VQINULODWGEVBB-UHFFFAOYSA-N.
| Molecular formula | C32H34ClN7O3 |
|---|---|
| Molecular weight | 600.1 g/mol |
| IUPAC name | 3-(2-chloro-6-methylphenyl)-7-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-1-(5-methoxy-2-pyridinyl)-4H-pyrimido[4,5-d]pyrimidin-2-one |
| InChIKey | VQINULODWGEVBB-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)N2CC3=CN=C(N=C3N(C2=O)C4=NC=C(C=C4)OC)NC5=C(C=C(C=C5)C6CCN(CC6)C)OC |
Computed by PubChem (NCBI)