CAS 223499-30-7 appears in our catalog under these names: YM 58483, YM-58483/ 99.93% (existing batch purity), CRAC Channel Inhibitor, BTP2, 99%, 99%, YM-58483, 99.38%, YM-58483 (Standard). Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 50mg, 5mg, 25mg, 100mg, 200mg, 1mg, 2mg.
N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-4-methylthiadiazole-5-carboxamide (CAS 223499-30-7) is a chemical compound with the molecular formula C15H9F6N5OS and a molecular weight of 421.3 g/mol. IUPAC name: N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-4-methylthiadiazole-5-carboxamide. InChIKey: XPRZIORDEVHURQ-UHFFFAOYSA-N.
| Molecular formula | C15H9F6N5OS |
|---|---|
| Molecular weight | 421.3 g/mol |
| IUPAC name | N-[4-[3,5-bis(trifluoromethyl)pyrazol-1-yl]phenyl]-4-methylthiadiazole-5-carboxamide |
| InChIKey | XPRZIORDEVHURQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SN=N1)C(=O)NC2=CC=C(C=C2)N3C(=CC(=N3)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)