cas: 35726-62-6 — see every product listed under this CAS number, including other names
Z-Glu(OEt)-OH 97% (CAS 35726-62-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A245772-5g |
| cas | 35726-62-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 303.62 Pln | |
| Ambeed | 10g | 515.00 Pln | |
| Ambeed | 25g | 848.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A245772 |
(2S)-5-ethoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid (CAS 35726-62-6) is a chemical compound with the molecular formula C15H19NO6 and a molecular weight of 309.31 g/mol. IUPAC name: (2S)-5-ethoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid. InChIKey: HRFYEAOTNUSCGI-LBPRGKRZSA-N.
| Molecular formula | C15H19NO6 |
|---|---|
| Molecular weight | 309.31 g/mol |
| IUPAC name | (2S)-5-ethoxy-5-oxo-2-(phenylmethoxycarbonylamino)pentanoic acid |
| InChIKey | HRFYEAOTNUSCGI-LBPRGKRZSA-N |
| SMILES | CCOC(=O)CC[C@@H](C(=O)O)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)