cas: 1016340-64-9 — see every product listed under this CAS number, including other names
Z57346765 95% (CAS 1016340-64-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1124391-1mg |
| cas | 1016340-64-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 253.56 Pln | |
| Ambeed | 5mg | 481.62 Pln | |
| Ambeed | 10mg | 687.44 Pln | |
| Ambeed | 25mg | 1299.31 Pln | |
| Ambeed | 50mg | 1944.56 Pln | |
| Ambeed | 100mg | 2940.25 Pln | |
| Ambeed | 250mg | 5754.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1124391 |
2-[[2-(4-methylanilino)quinazolin-4-yl]amino]ethanol (CAS 1016340-64-9) is a chemical compound with the molecular formula C17H18N4O and a molecular weight of 294.35 g/mol. IUPAC name: 2-[[2-(4-methylanilino)quinazolin-4-yl]amino]ethanol. InChIKey: GJTXWNCGKNQIFN-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O |
|---|---|
| Molecular weight | 294.35 g/mol |
| IUPAC name | 2-[[2-(4-methylanilino)quinazolin-4-yl]amino]ethanol |
| InChIKey | GJTXWNCGKNQIFN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC2=NC3=CC=CC=C3C(=N2)NCCO |
Computed by PubChem (NCBI)