cas: 1080028-80-3 — see every product listed under this CAS number, including other names
Zamicastat (CAS 1080028-80-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 5mg, 10mM (in 1ml dmso), 25mg, 50mg, 100mg, 200mg. Offered by: GLPBio, Biosynth, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC74778-1 |
| cas | 1080028-80-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 817.02 Pln | |
| GLPBio | 10mg | 1973.11 Pln | |
| GLPBio | 5mg | 1374.00 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 1261.67 Pln | |
| Biosynth | 25mg | price on request | |
| Biosynth | 10mg | price on request | |
| Biosynth | 50mg | price on request | |
| Biosynth | 100mg | price on request | |
| Chemat | 1mg | 578.00 Pln | |
| Chemat | 5mg | 1355.60 Pln | |
| Chemat | 10mg | 2099.60 Pln | |
| Chemat | 25mg | 3462.80 Pln | |
| Chemat | 50mg | 4782.80 Pln | |
| Chemat | 100mg | 6414.80 Pln | |
| Chemat | 200mg | 8531.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[2-(benzylamino)ethyl]-3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-1H-imidazole-2-thione (CAS 1080028-80-3) is a chemical compound with the molecular formula C21H21F2N3OS and a molecular weight of 401.5 g/mol. IUPAC name: 4-[2-(benzylamino)ethyl]-3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-1H-imidazole-2-thione. InChIKey: ZSSLCFLHEFXANG-GOSISDBHSA-N.
| Molecular formula | C21H21F2N3OS |
|---|---|
| Molecular weight | 401.5 g/mol |
| IUPAC name | 4-[2-(benzylamino)ethyl]-3-[(3R)-6,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-1H-imidazole-2-thione |
| InChIKey | ZSSLCFLHEFXANG-GOSISDBHSA-N |
| SMILES | C1[C@H](COC2=C1C=C(C=C2F)F)N3C(=CNC3=S)CCNCC4=CC=CC=C4 |
Computed by PubChem (NCBI)