cas: 15442-64-5 — see every product listed under this CAS number, including other names
Zinc Protoporphyrin, 98%, 98% (CAS 15442-64-5) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114U1D-5mg |
| cas | 15442-64-5 |
| size | 5mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 434.00 Pln | |
| Chemat | 10mg | 434.00 Pln | |
| Chemat | 25mg | 602.00 Pln | |
| Chemat | 50mg | 976.40 Pln | |
| Chemat | 100mg | 1264.40 Pln | |
| Chemat | 250mg | 2738.00 Pln | |
| Chemat | 1mg | 208.40 Pln | |
| Chemat | 1g | 7614.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Zinc 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid (CAS 15442-64-5) is a chemical compound with the molecular formula C34H32N4O4Zn and a molecular weight of 626.0 g/mol. IUPAC name: zinc 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid. InChIKey: FUTVBRXUIKZACV-UHFFFAOYSA-L.
| Molecular formula | C34H32N4O4Zn |
|---|---|
| Molecular weight | 626.0 g/mol |
| IUPAC name | zinc 3-[18-(2-carboxyethyl)-8,13-bis(ethenyl)-3,7,12,17-tetramethylporphyrin-21,24-diid-2-yl]propanoic acid |
| InChIKey | FUTVBRXUIKZACV-UHFFFAOYSA-L |
| SMILES | CC1=C(C2=CC3=C(C(=C([N-]3)C=C4C(=C(C(=N4)C=C5C(=C(C(=N5)C=C1[N-]2)C)C=C)C)C=C)C)CCC(=O)O)CCC(=O)O.[Zn+2] |
Computed by PubChem (NCBI)