CAS 14726-36-4 appears in our catalog under these names: Dibenzyldithiocarbamic Acid Zinc Salt, >95% (HPLC), Zinc(II) Dibenzyldithiocarbamate, Zinc(II) Dibenzyldithiocarbamate, >97.0%(T), Dibenzyldithiocarbamic acid zinc salt, 95%, Zinc dibenzyldithiocarbamate, 97%. Offered by: TRC, GLPBio, TCI, Thermo Scientific (Acros), Fluorochem. Available pack sizes: 10g, 1g, 5g, 500g, 25g, 100g.
Zinc bis(N,N-dibenzylcarbamodithioate) (CAS 14726-36-4) is a chemical compound with the molecular formula C30H28N2S4Zn and a molecular weight of 610.2 g/mol. IUPAC name: zinc bis(N,N-dibenzylcarbamodithioate). InChIKey: AUMBZPPBWALQRO-UHFFFAOYSA-L.
| Molecular formula | C30H28N2S4Zn |
|---|---|
| Molecular weight | 610.2 g/mol |
| IUPAC name | zinc bis(N,N-dibenzylcarbamodithioate) |
| InChIKey | AUMBZPPBWALQRO-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(=S)[S-].C1=CC=C(C=C1)CN(CC2=CC=CC=C2)C(=S)[S-].[Zn+2] |
Computed by PubChem (NCBI)